C17H21N3O3S2 — CID 2954250
1-[1-(4-ethoxyphenyl)ethyl]-3-(4-sulfamoylphenyl)thiourea (PubChem CID 2954250) has the molecular formula C17H21N3O3S2 and a molecular weight of 379.51 g/mol. Its IUPAC name is 1-[1-(4-ethoxyphenyl)ethyl]-3-(4-sulfamoylphenyl)thiourea.
| Compound Name | 1-[1-(4-ethoxyphenyl)ethyl]-3-(4-sulfamoylphenyl)thiourea |
|---|---|
| PubChem CID | 2954250 |
| Molecular Formula | C17H21N3O3S2 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 1-[1-(4-ethoxyphenyl)ethyl]-3-(4-sulfamoylphenyl)thiourea |
| SMILES | CCOc1ccc(C(C)NC(=S)Nc2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C17H21N3O3S2/c1-3-23-15-8-4-13(5-9-15)12(2)19-17(24)20-14-6-10-16(11-7-14)25(18,21)22/h4-12H,3H2,1-2H3,(H2,18,21,22)(H2,19,20,24) |
| InChIKey | FWWQSISCVPFVDH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|