C18H22N2O4S2 — CID 41095805
2-(4-ethoxyphenyl)sulfanyl-N-[(1R)-1-(4-sulfamoylphenyl)ethyl]acetamide (PubChem CID 41095805) has the molecular formula C18H22N2O4S2 and a molecular weight of 394.52 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)sulfanyl-N-[(1R)-1-(4-sulfamoylphenyl)ethyl]acetamide.
| Compound Name | 2-(4-ethoxyphenyl)sulfanyl-N-[(1R)-1-(4-sulfamoylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 41095805 |
| Molecular Formula | C18H22N2O4S2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 2-(4-ethoxyphenyl)sulfanyl-N-[(1R)-1-(4-sulfamoylphenyl)ethyl]acetamide |
| SMILES | CCOc1ccc(SCC(=O)N[C@H](C)c2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C18H22N2O4S2/c1-3-24-15-6-8-16(9-7-15)25-12-18(21)20-13(2)14-4-10-17(11-5-14)26(19,22)23/h4-11,13H,3,12H2,1-2H3,(H,20,21)(H2,19,22,23)/t13-/m1/s1 |
| InChIKey | UETJQWSSNYMITA-CYBMUJFWSA-N |
| XLogP | 2.70 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |