C20H24N2O6S — CID 16564974
[2-oxo-2-[1-(4-sulfamoylphenyl)ethylamino]ethyl] 2-(4-ethoxyphenyl)acetate (PubChem CID 16564974) has the molecular formula C20H24N2O6S and a molecular weight of 420.49 g/mol. Its IUPAC name is [2-oxo-2-[1-(4-sulfamoylphenyl)ethylamino]ethyl] 2-(4-ethoxyphenyl)acetate.
| Compound Name | [2-oxo-2-[1-(4-sulfamoylphenyl)ethylamino]ethyl] 2-(4-ethoxyphenyl)acetate |
|---|---|
| PubChem CID | 16564974 |
| Molecular Formula | C20H24N2O6S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | [2-oxo-2-[1-(4-sulfamoylphenyl)ethylamino]ethyl] 2-(4-ethoxyphenyl)acetate |
| SMILES | CCOc1ccc(CC(=O)OCC(=O)NC(C)c2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C20H24N2O6S/c1-3-27-17-8-4-15(5-9-17)12-20(24)28-13-19(23)22-14(2)16-6-10-18(11-7-16)29(21,25)26/h4-11,14H,3,12-13H2,1-2H3,(H,22,23)(H2,21,25,26) |
| InChIKey | RGFJFGIEQHSHPE-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |