C19H22N2O6S — CID 9201232
[2-oxo-2-[[(1S)-1-(4-sulfamoylphenyl)ethyl]amino]ethyl] 2-(4-methoxyphenyl)acetate (PubChem CID 9201232) has the molecular formula C19H22N2O6S and a molecular weight of 406.46 g/mol. Its IUPAC name is [2-oxo-2-[[(1S)-1-(4-sulfamoylphenyl)ethyl]amino]ethyl] 2-(4-methoxyphenyl)acetate.
| Compound Name | [2-oxo-2-[[(1S)-1-(4-sulfamoylphenyl)ethyl]amino]ethyl] 2-(4-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 9201232 |
| Molecular Formula | C19H22N2O6S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | [2-oxo-2-[[(1S)-1-(4-sulfamoylphenyl)ethyl]amino]ethyl] 2-(4-methoxyphenyl)acetate |
| SMILES | COc1ccc(CC(=O)OCC(=O)N[C@@H](C)c2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C19H22N2O6S/c1-13(15-5-9-17(10-6-15)28(20,24)25)21-18(22)12-27-19(23)11-14-3-7-16(26-2)8-4-14/h3-10,13H,11-12H2,1-2H3,(H,21,22)(H2,20,24,25)/t13-/m0/s1 |
| InChIKey | YQMOXSSDKBBLGY-ZDUSSCGKSA-N |
| XLogP | 1.31 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |