C19H22N2O5S — CID 9230085
[2-oxo-2-[[(1S)-1-(4-sulfamoylphenyl)ethyl]amino]ethyl] 4-ethylbenzoate (PubChem CID 9230085) has the molecular formula C19H22N2O5S and a molecular weight of 390.46 g/mol. Its IUPAC name is [2-oxo-2-[[(1S)-1-(4-sulfamoylphenyl)ethyl]amino]ethyl] 4-ethylbenzoate.
| Compound Name | [2-oxo-2-[[(1S)-1-(4-sulfamoylphenyl)ethyl]amino]ethyl] 4-ethylbenzoate |
|---|---|
| PubChem CID | 9230085 |
| Molecular Formula | C19H22N2O5S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | [2-oxo-2-[[(1S)-1-(4-sulfamoylphenyl)ethyl]amino]ethyl] 4-ethylbenzoate |
| SMILES | CCc1ccc(C(=O)OCC(=O)N[C@@H](C)c2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C19H22N2O5S/c1-3-14-4-6-16(7-5-14)19(23)26-12-18(22)21-13(2)15-8-10-17(11-9-15)27(20,24)25/h4-11,13H,3,12H2,1-2H3,(H,21,22)(H2,20,24,25)/t13-/m0/s1 |
| InChIKey | DBXNEGIDVAXDJN-ZDUSSCGKSA-N |
| XLogP | 1.93 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |