C19H23N3O5S — CID 108510380
N'-[1-(4-methoxyphenyl)ethyl]-N-[2-(4-sulfamoylphenyl)ethyl]oxamide (PubChem CID 108510380) has the molecular formula C19H23N3O5S and a molecular weight of 405.48 g/mol. Its IUPAC name is N'-[1-(4-methoxyphenyl)ethyl]-N-[2-(4-sulfamoylphenyl)ethyl]oxamide.
| Compound Name | N'-[1-(4-methoxyphenyl)ethyl]-N-[2-(4-sulfamoylphenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 108510380 |
| Molecular Formula | C19H23N3O5S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | N'-[1-(4-methoxyphenyl)ethyl]-N-[2-(4-sulfamoylphenyl)ethyl]oxamide |
| SMILES | COc1ccc(C(C)NC(=O)C(=O)NCCc2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C19H23N3O5S/c1-13(15-5-7-16(27-2)8-6-15)22-19(24)18(23)21-12-11-14-3-9-17(10-4-14)28(20,25)26/h3-10,13H,11-12H2,1-2H3,(H,21,23)(H,22,24)(H2,20,25,26) |
| InChIKey | KIOVTKVRRWNZAZ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|