C15H22N2O5 — CID 108510377
N-(2,2-dimethoxyethyl)-N'-[1-(4-methoxyphenyl)ethyl]oxamide (PubChem CID 108510377) has the molecular formula C15H22N2O5 and a molecular weight of 310.35 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-N'-[1-(4-methoxyphenyl)ethyl]oxamide.
| Compound Name | N-(2,2-dimethoxyethyl)-N'-[1-(4-methoxyphenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 108510377 |
| Molecular Formula | C15H22N2O5 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-N'-[1-(4-methoxyphenyl)ethyl]oxamide |
| SMILES | COc1ccc(C(C)NC(=O)C(=O)NCC(OC)OC)cc1 |
| InChI | InChI=1S/C15H22N2O5/c1-10(11-5-7-12(20-2)8-6-11)17-15(19)14(18)16-9-13(21-3)22-4/h5-8,10,13H,9H2,1-4H3,(H,16,18)(H,17,19) |
| InChIKey | GXWMAZYZEZXZHA-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|