C15H22N2O3 — CID 124605637
N-[(2S)-butan-2-yl]-N'-[(1R)-1-(4-methoxyphenyl)ethyl]oxamide (PubChem CID 124605637) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-N'-[(1R)-1-(4-methoxyphenyl)ethyl]oxamide.
| Compound Name | N-[(2S)-butan-2-yl]-N'-[(1R)-1-(4-methoxyphenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 124605637 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | N-[(2S)-butan-2-yl]-N'-[(1R)-1-(4-methoxyphenyl)ethyl]oxamide |
| SMILES | CC[C@H](C)NC(=O)C(=O)N[C@H](C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C15H22N2O3/c1-5-10(2)16-14(18)15(19)17-11(3)12-6-8-13(20-4)9-7-12/h6-11H,5H2,1-4H3,(H,16,18)(H,17,19)/t10-,11+/m0/s1 |
| InChIKey | JSKUIQKVOJJOIH-WDEREUQCSA-N |
| XLogP | 1.79 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|