C14H16N4O2S2 — CID 2957361
1-(1-pyridin-4-ylethyl)-3-(4-sulfamoylphenyl)thiourea (PubChem CID 2957361) has the molecular formula C14H16N4O2S2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 1-(1-pyridin-4-ylethyl)-3-(4-sulfamoylphenyl)thiourea.
| Compound Name | 1-(1-pyridin-4-ylethyl)-3-(4-sulfamoylphenyl)thiourea |
|---|---|
| PubChem CID | 2957361 |
| Molecular Formula | C14H16N4O2S2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 1-(1-pyridin-4-ylethyl)-3-(4-sulfamoylphenyl)thiourea |
| SMILES | CC(NC(=S)Nc1ccc(S(N)(=O)=O)cc1)c1ccncc1 |
| InChI | InChI=1S/C14H16N4O2S2/c1-10(11-6-8-16-9-7-11)17-14(21)18-12-2-4-13(5-3-12)22(15,19)20/h2-10H,1H3,(H2,15,19,20)(H2,17,18,21) |
| InChIKey | WQLIGOJSKXJCQX-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|