C13H14N4O2S2 — CID 3261165
1-(pyridin-4-ylmethyl)-3-(4-sulfamoylphenyl)thiourea (PubChem CID 3261165) has the molecular formula C13H14N4O2S2 and a molecular weight of 322.42 g/mol. Its IUPAC name is 1-(pyridin-4-ylmethyl)-3-(4-sulfamoylphenyl)thiourea.
| Compound Name | 1-(pyridin-4-ylmethyl)-3-(4-sulfamoylphenyl)thiourea |
|---|---|
| PubChem CID | 3261165 |
| Molecular Formula | C13H14N4O2S2 |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 1-(pyridin-4-ylmethyl)-3-(4-sulfamoylphenyl)thiourea |
| SMILES | NS(=O)(=O)c1ccc(NC(=S)NCc2ccncc2)cc1 |
| InChI | InChI=1S/C13H14N4O2S2/c14-21(18,19)12-3-1-11(2-4-12)17-13(20)16-9-10-5-7-15-8-6-10/h1-8H,9H2,(H2,14,18,19)(H2,16,17,20) |
| InChIKey | UVGDCTFTYDEPGW-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|