C20H19FN4O2S2 — CID 175587898
1-[4-[(3-fluorophenyl)methylsulfamoyl]phenyl]-3-(pyridin-4-ylmethyl)thiourea (PubChem CID 175587898) has the molecular formula C20H19FN4O2S2 and a molecular weight of 430.53 g/mol. Its IUPAC name is 1-[4-[(3-fluorophenyl)methylsulfamoyl]phenyl]-3-(pyridin-4-ylmethyl)thiourea.
| Compound Name | 1-[4-[(3-fluorophenyl)methylsulfamoyl]phenyl]-3-(pyridin-4-ylmethyl)thiourea |
|---|---|
| PubChem CID | 175587898 |
| Molecular Formula | C20H19FN4O2S2 |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 1-[4-[(3-fluorophenyl)methylsulfamoyl]phenyl]-3-(pyridin-4-ylmethyl)thiourea |
| SMILES | O=S(=O)(NCc1cccc(F)c1)c1ccc(NC(=S)NCc2ccncc2)cc1 |
| InChI | InChI=1S/C20H19FN4O2S2/c21-17-3-1-2-16(12-17)14-24-29(26,27)19-6-4-18(5-7-19)25-20(28)23-13-15-8-10-22-11-9-15/h1-12,24H,13-14H2,(H2,23,25,28) |
| InChIKey | DFTKSHYDYJVCMO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|