C20H20N4O3S — CID 135231284
1-[3-(benzylsulfamoyl)phenyl]-3-(pyridin-4-ylmethyl)urea (PubChem CID 135231284) has the molecular formula C20H20N4O3S and a molecular weight of 396.47 g/mol. Its IUPAC name is 1-[3-(benzylsulfamoyl)phenyl]-3-(pyridin-4-ylmethyl)urea.
| Compound Name | 1-[3-(benzylsulfamoyl)phenyl]-3-(pyridin-4-ylmethyl)urea |
|---|---|
| PubChem CID | 135231284 |
| Molecular Formula | C20H20N4O3S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 1-[3-(benzylsulfamoyl)phenyl]-3-(pyridin-4-ylmethyl)urea |
| SMILES | O=C(NCc1ccncc1)Nc1cccc(S(=O)(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C20H20N4O3S/c25-20(22-14-17-9-11-21-12-10-17)24-18-7-4-8-19(13-18)28(26,27)23-15-16-5-2-1-3-6-16/h1-13,23H,14-15H2,(H2,22,24,25) |
| InChIKey | QQCUJSWTFIPFKE-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |