C20H19BrN4O3S — CID 171778499
1-[4-[(2-bromophenyl)methylsulfamoyl]phenyl]-3-(pyridin-4-ylmethyl)urea (PubChem CID 171778499) has the molecular formula C20H19BrN4O3S and a molecular weight of 475.37 g/mol. Its IUPAC name is 1-[4-[(2-bromophenyl)methylsulfamoyl]phenyl]-3-(pyridin-4-ylmethyl)urea.
| Compound Name | 1-[4-[(2-bromophenyl)methylsulfamoyl]phenyl]-3-(pyridin-4-ylmethyl)urea |
|---|---|
| PubChem CID | 171778499 |
| Molecular Formula | C20H19BrN4O3S |
| Molecular Weight | 475.37 g/mol |
| Exact Mass | 474.04 |
| IUPAC Name | 1-[4-[(2-bromophenyl)methylsulfamoyl]phenyl]-3-(pyridin-4-ylmethyl)urea |
| SMILES | O=C(NCc1ccncc1)Nc1ccc(S(=O)(=O)NCc2ccccc2Br)cc1 |
| InChI | InChI=1S/C20H19BrN4O3S/c21-19-4-2-1-3-16(19)14-24-29(27,28)18-7-5-17(6-8-18)25-20(26)23-13-15-9-11-22-12-10-15/h1-12,24H,13-14H2,(H2,23,25,26) |
| InChIKey | WZNRGLXTRBWVAY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.37 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |