C21H19F3N4O3S2 — CID 175587630
1-(pyridin-4-ylmethyl)-3-[4-[[2-(trifluoromethoxy)phenyl]methylsulfamoyl]phenyl]thiourea (PubChem CID 175587630) has the molecular formula C21H19F3N4O3S2 and a molecular weight of 496.54 g/mol. Its IUPAC name is 1-(pyridin-4-ylmethyl)-3-[4-[[2-(trifluoromethoxy)phenyl]methylsulfamoyl]phenyl]thiourea.
| Compound Name | 1-(pyridin-4-ylmethyl)-3-[4-[[2-(trifluoromethoxy)phenyl]methylsulfamoyl]phenyl]thiourea |
|---|---|
| PubChem CID | 175587630 |
| Molecular Formula | C21H19F3N4O3S2 |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | 1-(pyridin-4-ylmethyl)-3-[4-[[2-(trifluoromethoxy)phenyl]methylsulfamoyl]phenyl]thiourea |
| SMILES | O=S(=O)(NCc1ccccc1OC(F)(F)F)c1ccc(NC(=S)NCc2ccncc2)cc1 |
| InChI | InChI=1S/C21H19F3N4O3S2/c22-21(23,24)31-19-4-2-1-3-16(19)14-27-33(29,30)18-7-5-17(6-8-18)28-20(32)26-13-15-9-11-25-12-10-15/h1-12,27H,13-14H2,(H2,26,28,32) |
| InChIKey | WDSASAVVHQWKKY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|