C23H21ClF3N3O4S2 — CID 11685488
1-[4-[(2-chloro-4-hydroxy-5-methoxyphenyl)methylsulfamoyl]phenyl]-3-[[4-(trifluoromethyl)phenyl]methyl]thiourea (PubChem CID 11685488) has the molecular formula C23H21ClF3N3O4S2 and a molecular weight of 560.02 g/mol. Its IUPAC name is 1-[4-[(2-chloro-4-hydroxy-5-methoxyphenyl)methylsulfamoyl]phenyl]-3-[[4-(trifluoromethyl)phenyl]methyl]thiourea.
| Compound Name | 1-[4-[(2-chloro-4-hydroxy-5-methoxyphenyl)methylsulfamoyl]phenyl]-3-[[4-(trifluoromethyl)phenyl]methyl]thiourea |
|---|---|
| PubChem CID | 11685488 |
| Molecular Formula | C23H21ClF3N3O4S2 |
| Molecular Weight | 560.02 g/mol |
| Exact Mass | 559.06 |
| IUPAC Name | 1-[4-[(2-chloro-4-hydroxy-5-methoxyphenyl)methylsulfamoyl]phenyl]-3-[[4-(trifluoromethyl)phenyl]methyl]thiourea |
| SMILES | COc1cc(CNS(=O)(=O)c2ccc(NC(=S)NCc3ccc(C(F)(F)F)cc3)cc2)c(Cl)cc1O |
| InChI | InChI=1S/C23H21ClF3N3O4S2/c1-34-21-10-15(19(24)11-20(21)31)13-29-36(32,33)18-8-6-17(7-9-18)30-22(35)28-12-14-2-4-16(5-3-14)23(25,26)27/h2-11,29,31H,12-13H2,1H3,(H2,28,30,35) |
| InChIKey | MGEWOYWQCIDUHX-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.02 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|