C20H18Cl2N4O2S2 — CID 175587617
1-[4-[(2,5-dichlorophenyl)methylsulfamoyl]phenyl]-3-(pyridin-4-ylmethyl)thiourea (PubChem CID 175587617) has the molecular formula C20H18Cl2N4O2S2 and a molecular weight of 481.43 g/mol. Its IUPAC name is 1-[4-[(2,5-dichlorophenyl)methylsulfamoyl]phenyl]-3-(pyridin-4-ylmethyl)thiourea.
| Compound Name | 1-[4-[(2,5-dichlorophenyl)methylsulfamoyl]phenyl]-3-(pyridin-4-ylmethyl)thiourea |
|---|---|
| PubChem CID | 175587617 |
| Molecular Formula | C20H18Cl2N4O2S2 |
| Molecular Weight | 481.43 g/mol |
| Exact Mass | 480.02 |
| IUPAC Name | 1-[4-[(2,5-dichlorophenyl)methylsulfamoyl]phenyl]-3-(pyridin-4-ylmethyl)thiourea |
| SMILES | O=S(=O)(NCc1cc(Cl)ccc1Cl)c1ccc(NC(=S)NCc2ccncc2)cc1 |
| InChI | InChI=1S/C20H18Cl2N4O2S2/c21-16-1-6-19(22)15(11-16)13-25-30(27,28)18-4-2-17(3-5-18)26-20(29)24-12-14-7-9-23-10-8-14/h1-11,25H,12-13H2,(H2,24,26,29) |
| InChIKey | XZXBRSPNDZARAQ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|