C15H13Cl3N2O3S — CID 3751983
N-[2-chloro-4-[(2,5-dichlorophenyl)methylsulfamoyl]phenyl]acetamide (PubChem CID 3751983) has the molecular formula C15H13Cl3N2O3S and a molecular weight of 407.71 g/mol. Its IUPAC name is N-[2-chloro-4-[(2,5-dichlorophenyl)methylsulfamoyl]phenyl]acetamide.
| Compound Name | N-[2-chloro-4-[(2,5-dichlorophenyl)methylsulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 3751983 |
| Molecular Formula | C15H13Cl3N2O3S |
| Molecular Weight | 407.71 g/mol |
| Exact Mass | 405.97 |
| IUPAC Name | N-[2-chloro-4-[(2,5-dichlorophenyl)methylsulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NCc2cc(Cl)ccc2Cl)cc1Cl |
| InChI | InChI=1S/C15H13Cl3N2O3S/c1-9(21)20-15-5-3-12(7-14(15)18)24(22,23)19-8-10-6-11(16)2-4-13(10)17/h2-7,19H,8H2,1H3,(H,20,21) |
| InChIKey | KVBIITBDRSSJGB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.71 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |