C15H14Cl2N2O3S — CID 25037659
N-[2-chloro-4-[(2-chlorophenyl)methylsulfamoyl]phenyl]acetamide (PubChem CID 25037659) has the molecular formula C15H14Cl2N2O3S and a molecular weight of 373.26 g/mol. Its IUPAC name is N-[2-chloro-4-[(2-chlorophenyl)methylsulfamoyl]phenyl]acetamide.
| Compound Name | N-[2-chloro-4-[(2-chlorophenyl)methylsulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 25037659 |
| Molecular Formula | C15H14Cl2N2O3S |
| Molecular Weight | 373.26 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | N-[2-chloro-4-[(2-chlorophenyl)methylsulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NCc2ccccc2Cl)cc1Cl |
| InChI | InChI=1S/C15H14Cl2N2O3S/c1-10(20)19-15-7-6-12(8-14(15)17)23(21,22)18-9-11-4-2-3-5-13(11)16/h2-8,18H,9H2,1H3,(H,19,20) |
| InChIKey | SHDBHHJHUQYYMV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.26 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |