C13H17ClN2O5S — CID 3849516
methyl 4-[(4-acetamido-3-chlorophenyl)sulfonylamino]butanoate (PubChem CID 3849516) has the molecular formula C13H17ClN2O5S and a molecular weight of 348.81 g/mol. Its IUPAC name is methyl 4-[(4-acetamido-3-chlorophenyl)sulfonylamino]butanoate.
| Compound Name | methyl 4-[(4-acetamido-3-chlorophenyl)sulfonylamino]butanoate |
|---|---|
| PubChem CID | 3849516 |
| Molecular Formula | C13H17ClN2O5S |
| Molecular Weight | 348.81 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | methyl 4-[(4-acetamido-3-chlorophenyl)sulfonylamino]butanoate |
| SMILES | COC(=O)CCCNS(=O)(=O)c1ccc(NC(C)=O)c(Cl)c1 |
| InChI | InChI=1S/C13H17ClN2O5S/c1-9(17)16-12-6-5-10(8-11(12)14)22(19,20)15-7-3-4-13(18)21-2/h5-6,8,15H,3-4,7H2,1-2H3,(H,16,17) |
| InChIKey | IFYCPPYTMZUJQB-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.81 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|