C11H12ClN3O3S — CID 3465665
N-[2-chloro-4-(2-cyanoethylsulfamoyl)phenyl]acetamide (PubChem CID 3465665) has the molecular formula C11H12ClN3O3S and a molecular weight of 301.76 g/mol. Its IUPAC name is N-[2-chloro-4-(2-cyanoethylsulfamoyl)phenyl]acetamide.
| Compound Name | N-[2-chloro-4-(2-cyanoethylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 3465665 |
| Molecular Formula | C11H12ClN3O3S |
| Molecular Weight | 301.76 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | N-[2-chloro-4-(2-cyanoethylsulfamoyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NCCC#N)cc1Cl |
| InChI | InChI=1S/C11H12ClN3O3S/c1-8(16)15-11-4-3-9(7-10(11)12)19(17,18)14-6-2-5-13/h3-4,7,14H,2,6H2,1H3,(H,15,16) |
| InChIKey | LGOXZCSIXXRQPW-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.76 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|