C14H15ClN4O3S — CID 3504516
N-[4-[bis(2-cyanoethyl)sulfamoyl]-2-chlorophenyl]acetamide (PubChem CID 3504516) has the molecular formula C14H15ClN4O3S and a molecular weight of 354.82 g/mol. Its IUPAC name is N-[4-[bis(2-cyanoethyl)sulfamoyl]-2-chlorophenyl]acetamide.
| Compound Name | N-[4-[bis(2-cyanoethyl)sulfamoyl]-2-chlorophenyl]acetamide |
|---|---|
| PubChem CID | 3504516 |
| Molecular Formula | C14H15ClN4O3S |
| Molecular Weight | 354.82 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | N-[4-[bis(2-cyanoethyl)sulfamoyl]-2-chlorophenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N(CCC#N)CCC#N)cc1Cl |
| InChI | InChI=1S/C14H15ClN4O3S/c1-11(20)18-14-5-4-12(10-13(14)15)23(21,22)19(8-2-6-16)9-3-7-17/h4-5,10H,2-3,8-9H2,1H3,(H,18,20) |
| InChIKey | FXOBITSIMHCWDU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 114.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.82 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |