C20H15Cl2N5O3S2 — CID 4085392
4-[bis(2-cyanoethyl)sulfamoyl]-N-(4,6-dichloro-1,3-benzothiazol-2-yl)benzamide (PubChem CID 4085392) has the molecular formula C20H15Cl2N5O3S2 and a molecular weight of 508.41 g/mol. Its IUPAC name is 4-[bis(2-cyanoethyl)sulfamoyl]-N-(4,6-dichloro-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 4-[bis(2-cyanoethyl)sulfamoyl]-N-(4,6-dichloro-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 4085392 |
| Molecular Formula | C20H15Cl2N5O3S2 |
| Molecular Weight | 508.41 g/mol |
| Exact Mass | 507.00 |
| IUPAC Name | 4-[bis(2-cyanoethyl)sulfamoyl]-N-(4,6-dichloro-1,3-benzothiazol-2-yl)benzamide |
| SMILES | N#CCCN(CCC#N)S(=O)(=O)c1ccc(C(=O)Nc2nc3c(Cl)cc(Cl)cc3s2)cc1 |
| InChI | InChI=1S/C20H15Cl2N5O3S2/c21-14-11-16(22)18-17(12-14)31-20(25-18)26-19(28)13-3-5-15(6-4-13)32(29,30)27(9-1-7-23)10-2-8-24/h3-6,11-12H,1-2,9-10H2,(H,25,26,28) |
| InChIKey | CQHHHAUAIAWMGR-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 126.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.41 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |