C16H13Cl2N3O3S2 — CID 2159265
N-(4,6-dichloro-1,3-benzothiazol-2-yl)-4-(dimethylsulfamoyl)benzamide (PubChem CID 2159265) has the molecular formula C16H13Cl2N3O3S2 and a molecular weight of 430.34 g/mol. Its IUPAC name is N-(4,6-dichloro-1,3-benzothiazol-2-yl)-4-(dimethylsulfamoyl)benzamide.
| Compound Name | N-(4,6-dichloro-1,3-benzothiazol-2-yl)-4-(dimethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 2159265 |
| Molecular Formula | C16H13Cl2N3O3S2 |
| Molecular Weight | 430.34 g/mol |
| Exact Mass | 428.98 |
| IUPAC Name | N-(4,6-dichloro-1,3-benzothiazol-2-yl)-4-(dimethylsulfamoyl)benzamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(=O)Nc2nc3c(Cl)cc(Cl)cc3s2)cc1 |
| InChI | InChI=1S/C16H13Cl2N3O3S2/c1-21(2)26(23,24)11-5-3-9(4-6-11)15(22)20-16-19-14-12(18)7-10(17)8-13(14)25-16/h3-8H,1-2H3,(H,19,20,22) |
| InChIKey | RQBWHJKLLRROOK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.34 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |