C21H9Cl4N5O2S2 — CID 43989361
2-N,6-N-bis(4,6-dichloro-1,3-benzothiazol-2-yl)pyridine-2,6-dicarboxamide (PubChem CID 43989361) has the molecular formula C21H9Cl4N5O2S2 and a molecular weight of 569.28 g/mol. Its IUPAC name is 2-N,6-N-bis(4,6-dichloro-1,3-benzothiazol-2-yl)pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis(4,6-dichloro-1,3-benzothiazol-2-yl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 43989361 |
| Molecular Formula | C21H9Cl4N5O2S2 |
| Molecular Weight | 569.28 g/mol |
| Exact Mass | 566.90 |
| IUPAC Name | 2-N,6-N-bis(4,6-dichloro-1,3-benzothiazol-2-yl)pyridine-2,6-dicarboxamide |
| SMILES | O=C(Nc1nc2c(Cl)cc(Cl)cc2s1)c1cccc(C(=O)Nc2nc3c(Cl)cc(Cl)cc3s2)n1 |
| InChI | InChI=1S/C21H9Cl4N5O2S2/c22-8-4-10(24)16-14(6-8)33-20(27-16)29-18(31)12-2-1-3-13(26-12)19(32)30-21-28-17-11(25)5-9(23)7-15(17)34-21/h1-7H,(H,27,29,31)(H,28,30,32) |
| InChIKey | GHMDIFAWDBWARN-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.28 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |