About N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)-5-phenyl-1,2-oxazole-3-carboxamide
N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)-5-phenyl-1,2-oxazole-3-carboxamide (PubChem CID 43989210) has the molecular formula C18H12ClN3O2S
and a molecular weight of 369.83 g/mol. Its IUPAC name is N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)-5-phenyl-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)-5-phenyl-1,2-oxazole-3-carboxamide |
| PubChem CID | 43989210 |
| Molecular Formula | C18H12ClN3O2S |
| Molecular Weight | 369.83 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)-5-phenyl-1,2-oxazole-3-carboxamide |
| SMILES | Cc1cc(Cl)cc2sc(NC(=O)c3cc(-c4ccccc4)on3)nc12 |
| InChI | InChI=1S/C18H12ClN3O2S/c1-10-7-12(19)8-15-16(10)20-18(25-15)21-17(23)13-9-14(24-22-13)11-5-3-2-4-6-11/h2-9H,1H3,(H,20,21,23) |
| InChIKey | IRLVYTDRBCGBDC-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.83 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)-5-phenyl-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)-5-phenyl-1,2-oxazole-3-carboxamide?
The IUPAC name of N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)-5-phenyl-1,2-oxazole-3-carboxamide (CID 43989210) is N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)-5-phenyl-1,2-oxazole-3-carboxamide.
What is the SMILES notation for N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)-5-phenyl-1,2-oxazole-3-carboxamide?
The canonical SMILES for N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)-5-phenyl-1,2-oxazole-3-carboxamide is Cc1cc(Cl)cc2sc(NC(=O)c3cc(-c4ccccc4)on3)nc12.
What is the InChIKey of N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)-5-phenyl-1,2-oxazole-3-carboxamide?
The InChIKey is IRLVYTDRBCGBDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12ClN3O2S/c1-10-7-12(19)8-15-16(10)20-18(25-15)21-17(23)13-9-14(24-22-13)11-5-3-2-4-6-11/h2-9H,1H3,(H,20,21,23).
What are the key properties of N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)-5-phenyl-1,2-oxazole-3-carboxamide?
N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)-5-phenyl-1,2-oxazole-3-carboxamide has a molecular weight of 369.83 g/mol, XLogP of 5.17, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)-5-phenyl-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 43989210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).