C18H17ClN2OS2 — CID 8700238
N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)-4-phenylsulfanylbutanamide (PubChem CID 8700238) has the molecular formula C18H17ClN2OS2 and a molecular weight of 376.93 g/mol. Its IUPAC name is N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)-4-phenylsulfanylbutanamide.
| Compound Name | N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)-4-phenylsulfanylbutanamide |
|---|---|
| PubChem CID | 8700238 |
| Molecular Formula | C18H17ClN2OS2 |
| Molecular Weight | 376.93 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)-4-phenylsulfanylbutanamide |
| SMILES | Cc1cc(Cl)cc2sc(NC(=O)CCCSc3ccccc3)nc12 |
| InChI | InChI=1S/C18H17ClN2OS2/c1-12-10-13(19)11-15-17(12)21-18(24-15)20-16(22)8-5-9-23-14-6-3-2-4-7-14/h2-4,6-7,10-11H,5,8-9H2,1H3,(H,20,21,22) |
| InChIKey | KXWZAXDZZXICNV-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.93 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|