C21H19ClN2O2S2 — CID 41272183
N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-4-(4-chlorophenyl)sulfanylbutanamide (PubChem CID 41272183) has the molecular formula C21H19ClN2O2S2 and a molecular weight of 430.98 g/mol. Its IUPAC name is N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-4-(4-chlorophenyl)sulfanylbutanamide.
| Compound Name | N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-4-(4-chlorophenyl)sulfanylbutanamide |
|---|---|
| PubChem CID | 41272183 |
| Molecular Formula | C21H19ClN2O2S2 |
| Molecular Weight | 430.98 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-4-(4-chlorophenyl)sulfanylbutanamide |
| SMILES | CC(=O)c1sc(NC(=O)CCCSc2ccc(Cl)cc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C21H19ClN2O2S2/c1-14(25)20-19(15-6-3-2-4-7-15)24-21(28-20)23-18(26)8-5-13-27-17-11-9-16(22)10-12-17/h2-4,6-7,9-12H,5,8,13H2,1H3,(H,23,24,26) |
| InChIKey | YSQNDPRJYLMMTG-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.98 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|