C25H19ClN2O2S2 — CID 44994230
N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-3-(4-chlorophenyl)sulfanylpropanamide (PubChem CID 44994230) has the molecular formula C25H19ClN2O2S2 and a molecular weight of 479.03 g/mol. Its IUPAC name is N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-3-(4-chlorophenyl)sulfanylpropanamide.
| Compound Name | N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-3-(4-chlorophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 44994230 |
| Molecular Formula | C25H19ClN2O2S2 |
| Molecular Weight | 479.03 g/mol |
| Exact Mass | 478.06 |
| IUPAC Name | N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-3-(4-chlorophenyl)sulfanylpropanamide |
| SMILES | O=C(CCSc1ccc(Cl)cc1)Nc1nc(-c2ccccc2)c(C(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C25H19ClN2O2S2/c26-19-11-13-20(14-12-19)31-16-15-21(29)27-25-28-22(17-7-3-1-4-8-17)24(32-25)23(30)18-9-5-2-6-10-18/h1-14H,15-16H2,(H,27,28,29) |
| InChIKey | GOHDTLUIJMXAGC-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.03 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |