About N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-3-(4-chlorophenyl)sulfanylpropanamide
N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-3-(4-chlorophenyl)sulfanylpropanamide (PubChem CID 44994230) has the molecular formula C25H19ClN2O2S2
and a molecular weight of 479.03 g/mol. Its IUPAC name is N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-3-(4-chlorophenyl)sulfanylpropanamide.
Molecular Properties
| Compound Name | N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-3-(4-chlorophenyl)sulfanylpropanamide |
| PubChem CID | 44994230 |
| Molecular Formula | C25H19ClN2O2S2 |
| Molecular Weight | 479.03 g/mol |
| Exact Mass | 478.06 |
| IUPAC Name | N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-3-(4-chlorophenyl)sulfanylpropanamide |
| SMILES | O=C(CCSc1ccc(Cl)cc1)Nc1nc(-c2ccccc2)c(C(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C25H19ClN2O2S2/c26-19-11-13-20(14-12-19)31-16-15-21(29)27-25-28-22(17-7-3-1-4-8-17)24(32-25)23(30)18-9-5-2-6-10-18/h1-14H,15-16H2,(H,27,28,29) |
| InChIKey | GOHDTLUIJMXAGC-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 479.03 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-3-(4-chlorophenyl)sulfanylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-3-(4-chlorophenyl)sulfanylpropanamide?
The IUPAC name of N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-3-(4-chlorophenyl)sulfanylpropanamide (CID 44994230) is N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-3-(4-chlorophenyl)sulfanylpropanamide.
What is the SMILES notation for N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-3-(4-chlorophenyl)sulfanylpropanamide?
The canonical SMILES for N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-3-(4-chlorophenyl)sulfanylpropanamide is O=C(CCSc1ccc(Cl)cc1)Nc1nc(-c2ccccc2)c(C(=O)c2ccccc2)s1.
What is the InChIKey of N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-3-(4-chlorophenyl)sulfanylpropanamide?
The InChIKey is GOHDTLUIJMXAGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H19ClN2O2S2/c26-19-11-13-20(14-12-19)31-16-15-21(29)27-25-28-22(17-7-3-1-4-8-17)24(32-25)23(30)18-9-5-2-6-10-18/h1-14H,15-16H2,(H,27,28,29).
What are the key properties of N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-3-(4-chlorophenyl)sulfanylpropanamide?
N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-3-(4-chlorophenyl)sulfanylpropanamide has a molecular weight of 479.03 g/mol, XLogP of 6.82, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-3-(4-chlorophenyl)sulfanylpropanamide is sourced from PubChem (CID 44994230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).