C23H15ClN2O2S — CID 4274612
N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-4-chlorobenzamide (PubChem CID 4274612) has the molecular formula C23H15ClN2O2S and a molecular weight of 418.91 g/mol. Its IUPAC name is N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-4-chlorobenzamide.
| Compound Name | N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-4-chlorobenzamide |
|---|---|
| PubChem CID | 4274612 |
| Molecular Formula | C23H15ClN2O2S |
| Molecular Weight | 418.91 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-4-chlorobenzamide |
| SMILES | O=C(Nc1nc(-c2ccccc2)c(C(=O)c2ccccc2)s1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H15ClN2O2S/c24-18-13-11-17(12-14-18)22(28)26-23-25-19(15-7-3-1-4-8-15)21(29-23)20(27)16-9-5-2-6-10-16/h1-14H,(H,25,26,28) |
| InChIKey | IABINRHFZHCACE-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.91 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |