C18H13ClN2O3S — CID 39200227
2-[2-benzamido-4-(4-chlorophenyl)-1,3-thiazol-5-yl]acetic acid (PubChem CID 39200227) has the molecular formula C18H13ClN2O3S and a molecular weight of 372.83 g/mol. Its IUPAC name is 2-[2-benzamido-4-(4-chlorophenyl)-1,3-thiazol-5-yl]acetic acid.
| Compound Name | 2-[2-benzamido-4-(4-chlorophenyl)-1,3-thiazol-5-yl]acetic acid |
|---|---|
| PubChem CID | 39200227 |
| Molecular Formula | C18H13ClN2O3S |
| Molecular Weight | 372.83 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | 2-[2-benzamido-4-(4-chlorophenyl)-1,3-thiazol-5-yl]acetic acid |
| SMILES | O=C(O)Cc1sc(NC(=O)c2ccccc2)nc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H13ClN2O3S/c19-13-8-6-11(7-9-13)16-14(10-15(22)23)25-18(20-16)21-17(24)12-4-2-1-3-5-12/h1-9H,10H2,(H,22,23)(H,20,21,24) |
| InChIKey | OWYDPFUNZMCXCQ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.83 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |