C23H16ClNO2S — CID 35211552
2-[2-(4-chlorophenyl)-4-(4-phenylphenyl)-1,3-thiazol-5-yl]acetic acid (PubChem CID 35211552) has the molecular formula C23H16ClNO2S and a molecular weight of 405.91 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-4-(4-phenylphenyl)-1,3-thiazol-5-yl]acetic acid.
| Compound Name | 2-[2-(4-chlorophenyl)-4-(4-phenylphenyl)-1,3-thiazol-5-yl]acetic acid |
|---|---|
| PubChem CID | 35211552 |
| Molecular Formula | C23H16ClNO2S |
| Molecular Weight | 405.91 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-4-(4-phenylphenyl)-1,3-thiazol-5-yl]acetic acid |
| SMILES | O=C(O)Cc1sc(-c2ccc(Cl)cc2)nc1-c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H16ClNO2S/c24-19-12-10-18(11-13-19)23-25-22(20(28-23)14-21(26)27)17-8-6-16(7-9-17)15-4-2-1-3-5-15/h1-13H,14H2,(H,26,27) |
| InChIKey | PHIMMNHOPBSCKI-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.91 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |