C16H12ClNS — CID 28709890
5-(chloromethyl)-2,4-diphenyl-1,3-thiazole (PubChem CID 28709890) has the molecular formula C16H12ClNS and a molecular weight of 285.80 g/mol. Its IUPAC name is 5-(chloromethyl)-2,4-diphenyl-1,3-thiazole.
| Compound Name | 5-(chloromethyl)-2,4-diphenyl-1,3-thiazole |
|---|---|
| PubChem CID | 28709890 |
| Molecular Formula | C16H12ClNS |
| Molecular Weight | 285.80 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 5-(chloromethyl)-2,4-diphenyl-1,3-thiazole |
| SMILES | ClCc1sc(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C16H12ClNS/c17-11-14-15(12-7-3-1-4-8-12)18-16(19-14)13-9-5-2-6-10-13/h1-10H,11H2 |
| InChIKey | CPEJTKZIKKKNMD-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.80 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|