C15H14N2S2 — CID 79786144
2-(4-phenyl-2-thiophen-3-yl-1,3-thiazol-5-yl)ethanamine (PubChem CID 79786144) has the molecular formula C15H14N2S2 and a molecular weight of 286.43 g/mol. Its IUPAC name is 2-(4-phenyl-2-thiophen-3-yl-1,3-thiazol-5-yl)ethanamine.
| Compound Name | 2-(4-phenyl-2-thiophen-3-yl-1,3-thiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 79786144 |
| Molecular Formula | C15H14N2S2 |
| Molecular Weight | 286.43 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 2-(4-phenyl-2-thiophen-3-yl-1,3-thiazol-5-yl)ethanamine |
| SMILES | NCCc1sc(-c2ccsc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C15H14N2S2/c16-8-6-13-14(11-4-2-1-3-5-11)17-15(19-13)12-7-9-18-10-12/h1-5,7,9-10H,6,8,16H2 |
| InChIKey | RMXPILSYYCLDPC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.43 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |