C16H15N3S2 — CID 10335742
5-ethyl-4-(4-phenyl-1,3-thiazol-2-yl)thiophene-2-carboximidamide (PubChem CID 10335742) has the molecular formula C16H15N3S2 and a molecular weight of 313.45 g/mol. Its IUPAC name is 5-ethyl-4-(4-phenyl-1,3-thiazol-2-yl)thiophene-2-carboximidamide.
| Compound Name | 5-ethyl-4-(4-phenyl-1,3-thiazol-2-yl)thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 10335742 |
| Molecular Formula | C16H15N3S2 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 5-ethyl-4-(4-phenyl-1,3-thiazol-2-yl)thiophene-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(-c2nc(-c3ccccc3)cs2)c(CC)s1 |
| InChI | InChI=1S/C16H15N3S2/c1-2-13-11(8-14(21-13)15(17)18)16-19-12(9-20-16)10-6-4-3-5-7-10/h3-9H,2H2,1H3,(H3,17,18) |
| InChIKey | BWSMAMUETYWTOR-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|