C11H10N2S2 — CID 724012
2-(4-phenyl-1,3-thiazol-2-yl)ethanethioamide (PubChem CID 724012) has the molecular formula C11H10N2S2 and a molecular weight of 234.35 g/mol. Its IUPAC name is 2-(4-phenyl-1,3-thiazol-2-yl)ethanethioamide.
| Compound Name | 2-(4-phenyl-1,3-thiazol-2-yl)ethanethioamide |
|---|---|
| PubChem CID | 724012 |
| Molecular Formula | C11H10N2S2 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 2-(4-phenyl-1,3-thiazol-2-yl)ethanethioamide |
| SMILES | NC(=S)Cc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C11H10N2S2/c12-10(14)6-11-13-9(7-15-11)8-4-2-1-3-5-8/h1-5,7H,6H2,(H2,12,14) |
| InChIKey | SSYYFONFBSKVFR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|