C15H16N2OS2 — CID 27439636
1-morpholin-4-yl-2-(4-phenyl-1,3-thiazol-2-yl)ethanethione (PubChem CID 27439636) has the molecular formula C15H16N2OS2 and a molecular weight of 304.44 g/mol. Its IUPAC name is 1-morpholin-4-yl-2-(4-phenyl-1,3-thiazol-2-yl)ethanethione.
| Compound Name | 1-morpholin-4-yl-2-(4-phenyl-1,3-thiazol-2-yl)ethanethione |
|---|---|
| PubChem CID | 27439636 |
| Molecular Formula | C15H16N2OS2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 1-morpholin-4-yl-2-(4-phenyl-1,3-thiazol-2-yl)ethanethione |
| SMILES | S=C(Cc1nc(-c2ccccc2)cs1)N1CCOCC1 |
| InChI | InChI=1S/C15H16N2OS2/c19-15(17-6-8-18-9-7-17)10-14-16-13(11-20-14)12-4-2-1-3-5-12/h1-5,11H,6-10H2 |
| InChIKey | DUJWYTPXOMGRAP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|