C24H30IN5OS — CID 111375388
2-methyl-1-[[2-(morpholin-4-ylmethyl)phenyl]methyl]-3-[(4-phenyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111375388) has the molecular formula C24H30IN5OS and a molecular weight of 563.51 g/mol. Its IUPAC name is 2-methyl-1-[[2-(morpholin-4-ylmethyl)phenyl]methyl]-3-[(4-phenyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[2-(morpholin-4-ylmethyl)phenyl]methyl]-3-[(4-phenyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111375388 |
| Molecular Formula | C24H30IN5OS |
| Molecular Weight | 563.51 g/mol |
| Exact Mass | 563.12 |
| IUPAC Name | 2-methyl-1-[[2-(morpholin-4-ylmethyl)phenyl]methyl]-3-[(4-phenyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1nc(-c2ccccc2)cs1)NCc1ccccc1CN1CCOCC1.I |
| InChI | InChI=1S/C24H29N5OS.HI/c1-25-24(27-16-23-28-22(18-31-23)19-7-3-2-4-8-19)26-15-20-9-5-6-10-21(20)17-29-11-13-30-14-12-29;/h2-10,18H,11-17H2,1H3,(H2,25,26,27);1H |
| InChIKey | DUXFOSOZFKABSI-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.51 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|