C17H17F3IN5S2 — CID 111616774
2-methyl-1-[(4-phenyl-1,3-thiazol-2-yl)methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide (PubChem CID 111616774) has the molecular formula C17H17F3IN5S2 and a molecular weight of 539.39 g/mol. Its IUPAC name is 2-methyl-1-[(4-phenyl-1,3-thiazol-2-yl)methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(4-phenyl-1,3-thiazol-2-yl)methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111616774 |
| Molecular Formula | C17H17F3IN5S2 |
| Molecular Weight | 539.39 g/mol |
| Exact Mass | 538.99 |
| IUPAC Name | 2-methyl-1-[(4-phenyl-1,3-thiazol-2-yl)methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1nc(-c2ccccc2)cs1)NCc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C17H16F3N5S2.HI/c1-21-16(23-8-15-25-13(10-27-15)17(18,19)20)22-7-14-24-12(9-26-14)11-5-3-2-4-6-11;/h2-6,9-10H,7-8H2,1H3,(H2,21,22,23);1H |
| InChIKey | ZLNMUVMKFVYIJW-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 62.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.39 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|