C16H21IN4S — CID 111869549
1-(cyclopropylmethyl)-2-methyl-3-[(4-phenyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111869549) has the molecular formula C16H21IN4S and a molecular weight of 428.34 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-2-methyl-3-[(4-phenyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(cyclopropylmethyl)-2-methyl-3-[(4-phenyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111869549 |
| Molecular Formula | C16H21IN4S |
| Molecular Weight | 428.34 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | 1-(cyclopropylmethyl)-2-methyl-3-[(4-phenyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1nc(-c2ccccc2)cs1)NCC1CC1.I |
| InChI | InChI=1S/C16H20N4S.HI/c1-17-16(18-9-12-7-8-12)19-10-15-20-14(11-21-15)13-5-3-2-4-6-13;/h2-6,11-12H,7-10H2,1H3,(H2,17,18,19);1H |
| InChIKey | BUFGKASGYKFZDF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|