C21H21F3N4OS — CID 111871929
2-methyl-1-[(4-phenyl-1,3-thiazol-2-yl)methyl]-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine (PubChem CID 111871929) has the molecular formula C21H21F3N4OS and a molecular weight of 434.49 g/mol. Its IUPAC name is 2-methyl-1-[(4-phenyl-1,3-thiazol-2-yl)methyl]-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine.
| Compound Name | 2-methyl-1-[(4-phenyl-1,3-thiazol-2-yl)methyl]-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111871929 |
| Molecular Formula | C21H21F3N4OS |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 2-methyl-1-[(4-phenyl-1,3-thiazol-2-yl)methyl]-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc(OCC(F)(F)F)cc1)NCc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C21H21F3N4OS/c1-25-20(26-11-15-7-9-17(10-8-15)29-14-21(22,23)24)27-12-19-28-18(13-30-19)16-5-3-2-4-6-16/h2-10,13H,11-12,14H2,1H3,(H2,25,26,27) |
| InChIKey | YSNWTQLXWAPCQW-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|