C19H15F3N2O2S — CID 55842822
N-[(4-phenyl-1,3-thiazol-2-yl)methyl]-4-(2,2,2-trifluoroethoxy)benzamide (PubChem CID 55842822) has the molecular formula C19H15F3N2O2S and a molecular weight of 392.40 g/mol. Its IUPAC name is N-[(4-phenyl-1,3-thiazol-2-yl)methyl]-4-(2,2,2-trifluoroethoxy)benzamide.
| Compound Name | N-[(4-phenyl-1,3-thiazol-2-yl)methyl]-4-(2,2,2-trifluoroethoxy)benzamide |
|---|---|
| PubChem CID | 55842822 |
| Molecular Formula | C19H15F3N2O2S |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | N-[(4-phenyl-1,3-thiazol-2-yl)methyl]-4-(2,2,2-trifluoroethoxy)benzamide |
| SMILES | O=C(NCc1nc(-c2ccccc2)cs1)c1ccc(OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H15F3N2O2S/c20-19(21,22)12-26-15-8-6-14(7-9-15)18(25)23-10-17-24-16(11-27-17)13-4-2-1-3-5-13/h1-9,11H,10,12H2,(H,23,25) |
| InChIKey | BUDGDTSBEARRPT-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |