C11H11N3OS — CID 73448477
N'-hydroxy-2-(4-phenyl-1,3-thiazol-2-yl)ethanimidamide (PubChem CID 73448477) has the molecular formula C11H11N3OS and a molecular weight of 233.30 g/mol. Its IUPAC name is N'-hydroxy-2-(4-phenyl-1,3-thiazol-2-yl)ethanimidamide.
| Compound Name | N'-hydroxy-2-(4-phenyl-1,3-thiazol-2-yl)ethanimidamide |
|---|---|
| PubChem CID | 73448477 |
| Molecular Formula | C11H11N3OS |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | N'-hydroxy-2-(4-phenyl-1,3-thiazol-2-yl)ethanimidamide |
| SMILES | NC(Cc1nc(-c2ccccc2)cs1)=NO |
| InChI | InChI=1S/C11H11N3OS/c12-10(14-15)6-11-13-9(7-16-11)8-4-2-1-3-5-8/h1-5,7,15H,6H2,(H2,12,14) |
| InChIKey | AGYSEFSWWGRKEB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|