C13H9N3OS2 — CID 105113691
2-(4-phenyl-1,3-thiazol-2-yl)-1-(thiadiazol-4-yl)ethanone (PubChem CID 105113691) has the molecular formula C13H9N3OS2 and a molecular weight of 287.37 g/mol. Its IUPAC name is 2-(4-phenyl-1,3-thiazol-2-yl)-1-(thiadiazol-4-yl)ethanone.
| Compound Name | 2-(4-phenyl-1,3-thiazol-2-yl)-1-(thiadiazol-4-yl)ethanone |
|---|---|
| PubChem CID | 105113691 |
| Molecular Formula | C13H9N3OS2 |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | 2-(4-phenyl-1,3-thiazol-2-yl)-1-(thiadiazol-4-yl)ethanone |
| SMILES | O=C(Cc1nc(-c2ccccc2)cs1)c1csnn1 |
| InChI | InChI=1S/C13H9N3OS2/c17-12(11-8-19-16-15-11)6-13-14-10(7-18-13)9-4-2-1-3-5-9/h1-5,7-8H,6H2 |
| InChIKey | UTBRXNDZYPDOMP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |