C12H10FNO2S — CID 79817950
2-fluoro-3-(4-phenyl-1,3-thiazol-2-yl)propanoic acid (PubChem CID 79817950) has the molecular formula C12H10FNO2S and a molecular weight of 251.28 g/mol. Its IUPAC name is 2-fluoro-3-(4-phenyl-1,3-thiazol-2-yl)propanoic acid.
| Compound Name | 2-fluoro-3-(4-phenyl-1,3-thiazol-2-yl)propanoic acid |
|---|---|
| PubChem CID | 79817950 |
| Molecular Formula | C12H10FNO2S |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | 2-fluoro-3-(4-phenyl-1,3-thiazol-2-yl)propanoic acid |
| SMILES | O=C(O)C(F)Cc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C12H10FNO2S/c13-9(12(15)16)6-11-14-10(7-17-11)8-4-2-1-3-5-8/h1-5,7,9H,6H2,(H,15,16) |
| InChIKey | RDXFQJYOBCLMPL-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |