C28H23NPS+ — CID 23143294
triphenyl-[(4-phenyl-1,3-thiazol-2-yl)methyl]phosphanium (PubChem CID 23143294) has the molecular formula C28H23NPS+ and a molecular weight of 436.54 g/mol. Its IUPAC name is triphenyl-[(4-phenyl-1,3-thiazol-2-yl)methyl]phosphanium.
| Compound Name | triphenyl-[(4-phenyl-1,3-thiazol-2-yl)methyl]phosphanium |
|---|---|
| PubChem CID | 23143294 |
| Molecular Formula | C28H23NPS+ |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | triphenyl-[(4-phenyl-1,3-thiazol-2-yl)methyl]phosphanium |
| SMILES | c1ccc(-c2csc(C[P+](c3ccccc3)(c3ccccc3)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C28H23NPS/c1-5-13-23(14-6-1)27-22-31-28(29-27)21-30(24-15-7-2-8-16-24,25-17-9-3-10-18-25)26-19-11-4-12-20-26/h1-20,22H,21H2/q+1 |
| InChIKey | VODZKVTVJCCAEW-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|