C14H15NOS — CID 79819550
1-cyclopropyl-2-(4-phenyl-1,3-thiazol-2-yl)ethanol (PubChem CID 79819550) has the molecular formula C14H15NOS and a molecular weight of 245.35 g/mol. Its IUPAC name is 1-cyclopropyl-2-(4-phenyl-1,3-thiazol-2-yl)ethanol.
| Compound Name | 1-cyclopropyl-2-(4-phenyl-1,3-thiazol-2-yl)ethanol |
|---|---|
| PubChem CID | 79819550 |
| Molecular Formula | C14H15NOS |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 1-cyclopropyl-2-(4-phenyl-1,3-thiazol-2-yl)ethanol |
| SMILES | OC(Cc1nc(-c2ccccc2)cs1)C1CC1 |
| InChI | InChI=1S/C14H15NOS/c16-13(11-6-7-11)8-14-15-12(9-17-14)10-4-2-1-3-5-10/h1-5,9,11,13,16H,6-8H2 |
| InChIKey | UGMHFFRAMOTAJG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |