C16H19NO2S — CID 103986612
1-(oxolan-3-yl)-3-(4-phenyl-1,3-thiazol-2-yl)propan-2-ol (PubChem CID 103986612) has the molecular formula C16H19NO2S and a molecular weight of 289.40 g/mol. Its IUPAC name is 1-(oxolan-3-yl)-3-(4-phenyl-1,3-thiazol-2-yl)propan-2-ol.
| Compound Name | 1-(oxolan-3-yl)-3-(4-phenyl-1,3-thiazol-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 103986612 |
| Molecular Formula | C16H19NO2S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 1-(oxolan-3-yl)-3-(4-phenyl-1,3-thiazol-2-yl)propan-2-ol |
| SMILES | OC(Cc1nc(-c2ccccc2)cs1)CC1CCOC1 |
| InChI | InChI=1S/C16H19NO2S/c18-14(8-12-6-7-19-10-12)9-16-17-15(11-20-16)13-4-2-1-3-5-13/h1-5,11-12,14,18H,6-10H2 |
| InChIKey | PGSWQXOLZOMCSX-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |