C17H19NOS — CID 115817879
1-(6-bicyclo[3.1.0]hexanyl)-2-(4-phenyl-1,3-thiazol-2-yl)ethanol (PubChem CID 115817879) has the molecular formula C17H19NOS and a molecular weight of 285.41 g/mol. Its IUPAC name is 1-(6-bicyclo[3.1.0]hexanyl)-2-(4-phenyl-1,3-thiazol-2-yl)ethanol.
| Compound Name | 1-(6-bicyclo[3.1.0]hexanyl)-2-(4-phenyl-1,3-thiazol-2-yl)ethanol |
|---|---|
| PubChem CID | 115817879 |
| Molecular Formula | C17H19NOS |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 1-(6-bicyclo[3.1.0]hexanyl)-2-(4-phenyl-1,3-thiazol-2-yl)ethanol |
| SMILES | OC(Cc1nc(-c2ccccc2)cs1)C1C2CCCC21 |
| InChI | InChI=1S/C17H19NOS/c19-15(17-12-7-4-8-13(12)17)9-16-18-14(10-20-16)11-5-2-1-3-6-11/h1-3,5-6,10,12-13,15,17,19H,4,7-9H2 |
| InChIKey | VSBYFEJCYZEHTF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |