C17H21NOS — CID 107192609
1-(2-methylcyclopentyl)-2-(4-phenyl-1,3-thiazol-2-yl)ethanol (PubChem CID 107192609) has the molecular formula C17H21NOS and a molecular weight of 287.43 g/mol. Its IUPAC name is 1-(2-methylcyclopentyl)-2-(4-phenyl-1,3-thiazol-2-yl)ethanol.
| Compound Name | 1-(2-methylcyclopentyl)-2-(4-phenyl-1,3-thiazol-2-yl)ethanol |
|---|---|
| PubChem CID | 107192609 |
| Molecular Formula | C17H21NOS |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 1-(2-methylcyclopentyl)-2-(4-phenyl-1,3-thiazol-2-yl)ethanol |
| SMILES | CC1CCCC1C(O)Cc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C17H21NOS/c1-12-6-5-9-14(12)16(19)10-17-18-15(11-20-17)13-7-3-2-4-8-13/h2-4,7-8,11-12,14,16,19H,5-6,9-10H2,1H3 |
| InChIKey | YLCWTOGWTWKATA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |