C15H19NO2S — CID 103456577
4-methyl-1-(4-phenyl-1,3-thiazol-2-yl)pentane-2,3-diol (PubChem CID 103456577) has the molecular formula C15H19NO2S and a molecular weight of 277.39 g/mol. Its IUPAC name is 4-methyl-1-(4-phenyl-1,3-thiazol-2-yl)pentane-2,3-diol.
| Compound Name | 4-methyl-1-(4-phenyl-1,3-thiazol-2-yl)pentane-2,3-diol |
|---|---|
| PubChem CID | 103456577 |
| Molecular Formula | C15H19NO2S |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 4-methyl-1-(4-phenyl-1,3-thiazol-2-yl)pentane-2,3-diol |
| SMILES | CC(C)C(O)C(O)Cc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C15H19NO2S/c1-10(2)15(18)13(17)8-14-16-12(9-19-14)11-6-4-3-5-7-11/h3-7,9-10,13,15,17-18H,8H2,1-2H3 |
| InChIKey | RKTZQORLOCHABM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |